Products 2376321-67-2
CAS 2376321-67-2 is the registry number for IQTub4P. Offered by: MedChemExpress. Available pack sizes: Get quote.
Disodium;[7-methoxy-1-(3,4,5-trimethoxyphenyl)isoquinolin-6-yl] phosphate (CAS 2376321-67-2) is a chemical compound with the molecular formula C19H18NNa2O8P and a molecular weight of 465.3 g/mol. IUPAC name: disodium;[7-methoxy-1-(3,4,5-trimethoxyphenyl)isoquinolin-6-yl] phosphate. InChIKey: AOEBAAQEAUUYGC-UHFFFAOYSA-L.
| Molecular formula | C19H18NNa2O8P |
|---|---|
| Molecular weight | 465.3 g/mol |
| IUPAC name | disodium;[7-methoxy-1-(3,4,5-trimethoxyphenyl)isoquinolin-6-yl] phosphate |
| InChIKey | AOEBAAQEAUUYGC-UHFFFAOYSA-L |
| SMILES | COC1=CC(=CC(=C1OC)OC)C2=NC=CC3=CC(=C(C=C32)OC)OP(=O)([O-])[O-].[Na+].[Na+] |
Computed by PubChem (NCBI)