CAS 2376322-12-0 appears in our catalog under these names: SWE101, 98%, SWE101, 4-(4-(3,4-Dichlorophenyl)-5-phenyloxazol-2-yl)butanoic acid, SWE101, 98.99%, SWE101, 99.41%. Offered by: AmBeed, GLPBio, Biosynth, MedChemExpress, Chemat. Available pack sizes: 100mg, 10mg, 25mg, 5mg, 50mg, 2mg, 10mM/1mL, 10 mg.
4-[4-(3,4-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid (CAS 2376322-12-0) is a chemical compound with the molecular formula C19H15Cl2NO3 and a molecular weight of 376.2 g/mol. IUPAC name: 4-[4-(3,4-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid. InChIKey: UIADWSXPNFQQCZ-UHFFFAOYSA-N.
| Molecular formula | C19H15Cl2NO3 |
|---|---|
| Molecular weight | 376.2 g/mol |
| IUPAC name | 4-[4-(3,4-dichlorophenyl)-5-phenyl-1,3-oxazol-2-yl]butanoic acid |
| InChIKey | UIADWSXPNFQQCZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(O2)CCCC(=O)O)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)