CAS 2376389-32-9 is the registry number for 4-(5-Chloro-2-(4-chloro-1H-1,2,3-triazol-1-yl)phenyl)-5-methoxypyridin-2(1H)-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-methoxy-1H-pyridin-2-one (CAS 2376389-32-9) is a chemical compound with the molecular formula C14H10Cl2N4O2 and a molecular weight of 337.2 g/mol. IUPAC name: 4-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-methoxy-1H-pyridin-2-one. InChIKey: VCCBXIRSNXUBQG-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2N4O2 |
|---|---|
| Molecular weight | 337.2 g/mol |
| IUPAC name | 4-[5-chloro-2-(4-chlorotriazol-1-yl)phenyl]-5-methoxy-1H-pyridin-2-one |
| InChIKey | VCCBXIRSNXUBQG-UHFFFAOYSA-N |
| SMILES | COC1=CNC(=O)C=C1C2=C(C=CC(=C2)Cl)N3C=C(N=N3)Cl |
Computed by PubChem (NCBI)