Products 2376694-72-1

CAS 2376694-72-1 is the registry number for WQ-C-401, 99.41%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 10mM/1mL, 5 mg, 25 mg, 50 mg, 100 mg.

Structural formula: {0} (CAS {1})

N-[4-methyl-3-[1-(1-methylimidazole-4-carbonyl)piperidin-4-yl]oxyphenyl]benzamide (CAS 2376694-72-1) is a chemical compound with the molecular formula C24H26N4O3 and a molecular weight of 418.5 g/mol. IUPAC name: N-[4-methyl-3-[1-(1-methylimidazole-4-carbonyl)piperidin-4-yl]oxyphenyl]benzamide. InChIKey: XNAMRKLFEPZCQN-UHFFFAOYSA-N.

Identity
Molecular formulaC24H26N4O3
Molecular weight418.5 g/mol
IUPAC nameN-[4-methyl-3-[1-(1-methylimidazole-4-carbonyl)piperidin-4-yl]oxyphenyl]benzamide
InChIKeyXNAMRKLFEPZCQN-UHFFFAOYSA-N
SMILESCC1=C(C=C(C=C1)NC(=O)C2=CC=CC=C2)OC3CCN(CC3)C(=O)C4=CN(C=N4)C

Computed by PubChem (NCBI)

Synonyms: orb2664877