CAS 2376694-72-1 is the registry number for WQ-C-401, 99.41%. Offered by: MedChemExpress. Available pack sizes: 10 mg, 10mM/1mL, 5 mg, 25 mg, 50 mg, 100 mg.
N-[4-methyl-3-[1-(1-methylimidazole-4-carbonyl)piperidin-4-yl]oxyphenyl]benzamide (CAS 2376694-72-1) is a chemical compound with the molecular formula C24H26N4O3 and a molecular weight of 418.5 g/mol. IUPAC name: N-[4-methyl-3-[1-(1-methylimidazole-4-carbonyl)piperidin-4-yl]oxyphenyl]benzamide. InChIKey: XNAMRKLFEPZCQN-UHFFFAOYSA-N.
| Molecular formula | C24H26N4O3 |
|---|---|
| Molecular weight | 418.5 g/mol |
| IUPAC name | N-[4-methyl-3-[1-(1-methylimidazole-4-carbonyl)piperidin-4-yl]oxyphenyl]benzamide |
| InChIKey | XNAMRKLFEPZCQN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC=CC=C2)OC3CCN(CC3)C(=O)C4=CN(C=N4)C |
Computed by PubChem (NCBI)