Products 2377030-96-9

CAS 2377030-96-9 is the registry number for 3-(Bicyclo[1.1.1]pentan-1-yl)azetidine 2,2,2-trifluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(1-bicyclo[1.1.1]pentanyl)azetidine;2,2,2-trifluoroacetic acid (CAS 2377030-96-9) is a chemical compound with the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. IUPAC name: 3-(1-bicyclo[1.1.1]pentanyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: UIDOYWZDLIJZJC-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14F3NO2
Molecular weight237.22 g/mol
IUPAC name3-(1-bicyclo[1.1.1]pentanyl)azetidine;2,2,2-trifluoroacetic acid
InChIKeyUIDOYWZDLIJZJC-UHFFFAOYSA-N
SMILESC1C2CC1(C2)C3CNC3.C(=O)(C(F)(F)F)O

Computed by PubChem (NCBI)