CAS 2377030-96-9 is the registry number for 3-(Bicyclo[1.1.1]pentan-1-yl)azetidine 2,2,2-trifluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(1-bicyclo[1.1.1]pentanyl)azetidine;2,2,2-trifluoroacetic acid (CAS 2377030-96-9) is a chemical compound with the molecular formula C10H14F3NO2 and a molecular weight of 237.22 g/mol. IUPAC name: 3-(1-bicyclo[1.1.1]pentanyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: UIDOYWZDLIJZJC-UHFFFAOYSA-N.
| Molecular formula | C10H14F3NO2 |
|---|---|
| Molecular weight | 237.22 g/mol |
| IUPAC name | 3-(1-bicyclo[1.1.1]pentanyl)azetidine;2,2,2-trifluoroacetic acid |
| InChIKey | UIDOYWZDLIJZJC-UHFFFAOYSA-N |
| SMILES | C1C2CC1(C2)C3CNC3.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)