Products 2377031-10-0

CAS 2377031-10-0 is the registry number for tert-Butyl N-(5-(2-methoxyethyl)-1,2-oxazol-3-yl)carbamate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Tert-butyl N-[5-(2-methoxyethyl)-1,2-oxazol-3-yl]carbamate (CAS 2377031-10-0) is a chemical compound with the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. IUPAC name: tert-butyl N-[5-(2-methoxyethyl)-1,2-oxazol-3-yl]carbamate. InChIKey: MWBFUBRPZZSOFU-UHFFFAOYSA-N.

Identity
Molecular formulaC11H18N2O4
Molecular weight242.27 g/mol
IUPAC nametert-butyl N-[5-(2-methoxyethyl)-1,2-oxazol-3-yl]carbamate
InChIKeyMWBFUBRPZZSOFU-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)NC1=NOC(=C1)CCOC

Computed by PubChem (NCBI)