CAS 2377031-91-7 is the registry number for Ethyl 2-amino-3-(3-chloro-2-fluorophenyl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
Ethyl 2-amino-3-(3-chloro-2-fluorophenyl)propanoate;hydrochloride (CAS 2377031-91-7) is a chemical compound with the molecular formula C11H14Cl2FNO2 and a molecular weight of 282.14 g/mol. IUPAC name: ethyl 2-amino-3-(3-chloro-2-fluorophenyl)propanoate;hydrochloride. InChIKey: HYZQEAXCMCHSIH-UHFFFAOYSA-N.
| Molecular formula | C11H14Cl2FNO2 |
|---|---|
| Molecular weight | 282.14 g/mol |
| IUPAC name | ethyl 2-amino-3-(3-chloro-2-fluorophenyl)propanoate;hydrochloride |
| InChIKey | HYZQEAXCMCHSIH-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CC1=C(C(=CC=C1)Cl)F)N.Cl |
Computed by PubChem (NCBI)