Products 2377031-91-7

CAS 2377031-91-7 is the registry number for Ethyl 2-amino-3-(3-chloro-2-fluorophenyl)propanoate hydrochloride. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 2-amino-3-(3-chloro-2-fluorophenyl)propanoate;hydrochloride (CAS 2377031-91-7) is a chemical compound with the molecular formula C11H14Cl2FNO2 and a molecular weight of 282.14 g/mol. IUPAC name: ethyl 2-amino-3-(3-chloro-2-fluorophenyl)propanoate;hydrochloride. InChIKey: HYZQEAXCMCHSIH-UHFFFAOYSA-N.

Identity
Molecular formulaC11H14Cl2FNO2
Molecular weight282.14 g/mol
IUPAC nameethyl 2-amino-3-(3-chloro-2-fluorophenyl)propanoate;hydrochloride
InChIKeyHYZQEAXCMCHSIH-UHFFFAOYSA-N
SMILESCCOC(=O)C(CC1=C(C(=CC=C1)Cl)F)N.Cl

Computed by PubChem (NCBI)