Products 2377233-79-7
CAS 2377233-79-7 is the registry number for 8-Fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-2(1H)-one, 98%, 98%. Offered by: Chemat. Available pack sizes: 100mg.
8-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinolin-2-one (CAS 2377233-79-7) is a chemical compound with the molecular formula C15H17BFNO3 and a molecular weight of 289.11 g/mol. IUPAC name: 8-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinolin-2-one. InChIKey: WKZUVRGYQGJAHM-UHFFFAOYSA-N.
| Molecular formula | C15H17BFNO3 |
|---|---|
| Molecular weight | 289.11 g/mol |
| IUPAC name | 8-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-quinolin-2-one |
| InChIKey | WKZUVRGYQGJAHM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C(=C2)F)NC(=O)C=C3 |
Computed by PubChem (NCBI)