Products 1704121-17-4
CAS 1704121-17-4 is the registry number for (2–Fluoro–5–(((4–methoxybenzyl)amino) methyl)phenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[2-fluoro-5-[[(4-methoxyphenyl)methylamino]methyl]phenyl]boronic acid (CAS 1704121-17-4) is a chemical compound with the molecular formula C15H17BFNO3 and a molecular weight of 289.11 g/mol. IUPAC name: [2-fluoro-5-[[(4-methoxyphenyl)methylamino]methyl]phenyl]boronic acid. InChIKey: ZKFIGZKBIRDVKD-UHFFFAOYSA-N.
| Molecular formula | C15H17BFNO3 |
|---|---|
| Molecular weight | 289.11 g/mol |
| IUPAC name | [2-fluoro-5-[[(4-methoxyphenyl)methylamino]methyl]phenyl]boronic acid |
| InChIKey | ZKFIGZKBIRDVKD-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)CNCC2=CC=C(C=C2)OC)F)(O)O |
Computed by PubChem (NCBI)