Products 2377356-06-2
CAS 2377356-06-2 appears in our catalog under these names: (R)-3H-Spiro[benzofuran-2,4'-piperidin]-3-amine dihydrochloride, 98%, 98%, (R)-3H-Spiro[benzofuran-2,4'-piperidin]-3-amine dihydrochloride, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(3R)-spiro[3H-1-benzofuran-2,4'-piperidine]-3-amine;dihydrochloride (CAS 2377356-06-2) is a chemical compound with the molecular formula C12H18Cl2N2O and a molecular weight of 277.19 g/mol. IUPAC name: (3R)-spiro[3H-1-benzofuran-2,4'-piperidine]-3-amine;dihydrochloride. InChIKey: BWPXOPFWXWARKN-NVJADKKVSA-N.
| Molecular formula | C12H18Cl2N2O |
|---|---|
| Molecular weight | 277.19 g/mol |
| IUPAC name | (3R)-spiro[3H-1-benzofuran-2,4'-piperidine]-3-amine;dihydrochloride |
| InChIKey | BWPXOPFWXWARKN-NVJADKKVSA-N |
| SMILES | C1CNCCC12[C@@H](C3=CC=CC=C3O2)N.Cl.Cl |
Computed by PubChem (NCBI)