Products 2377369-59-8

CAS 2377369-59-8 appears in our catalog under these names: 4-(3-Pyridyl)benzeneboronic acid hydrochloride, 95%, (4-(Pyridin-3-yl)phenyl)boronic acid hydrochloride, 98%, 4-(3-Pyridyl)phenylboronic Acid Hydrochloride (contains varying amounts of Anhydride), 4-(3-Pyridyl)benzeneboronic acid hydrochloride, ≥98%, ≥98%, 4-(3-Pyridyl)benzeneboronic acid hydrochloride, 98%. Offered by: Combi-blocks, AmBeed, TCI, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 50mg, 250mg.

(4-pyridin-3-ylphenyl)boronic acid;hydrochloride (CAS 2377369-59-8) is a chemical compound with the molecular formula C11H11BClNO2 and a molecular weight of 235.47 g/mol. IUPAC name: (4-pyridin-3-ylphenyl)boronic acid;hydrochloride. InChIKey: NLNURWGCLKVUJW-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11BClNO2
Molecular weight235.47 g/mol
IUPAC name(4-pyridin-3-ylphenyl)boronic acid;hydrochloride
InChIKeyNLNURWGCLKVUJW-UHFFFAOYSA-N
SMILESB(C1=CC=C(C=C1)C2=CN=CC=C2)(O)O.Cl

Computed by PubChem (NCBI)