Products 2377587-29-4
CAS 2377587-29-4 is the registry number for 4-[5-(1-Phenylpentyl)-1,2,4-oxadiazol-3-yl]phenylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[4-[5-(1-phenylpentyl)-1,2,4-oxadiazol-3-yl]phenyl]boronic acid (CAS 2377587-29-4) is a chemical compound with the molecular formula C19H21BN2O3 and a molecular weight of 336.2 g/mol. IUPAC name: [4-[5-(1-phenylpentyl)-1,2,4-oxadiazol-3-yl]phenyl]boronic acid. InChIKey: YYRWOXGGRGJEOP-UHFFFAOYSA-N.
| Molecular formula | C19H21BN2O3 |
|---|---|
| Molecular weight | 336.2 g/mol |
| IUPAC name | [4-[5-(1-phenylpentyl)-1,2,4-oxadiazol-3-yl]phenyl]boronic acid |
| InChIKey | YYRWOXGGRGJEOP-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=NOC(=N2)C(CCCC)C3=CC=CC=C3)(O)O |
Computed by PubChem (NCBI)