CAS 2377587-30-7 appears in our catalog under these names: [4-(1-methanesulfonyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]boronic acid, 95%, (4-(1-methanesulfonyl-3,6-dihydro-2H-pyridin-4-yl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
[4-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]boronic acid (CAS 2377587-30-7) is a chemical compound with the molecular formula C12H16BNO4S and a molecular weight of 281.14 g/mol. IUPAC name: [4-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]boronic acid. InChIKey: XUYQXOSHBCQDRS-UHFFFAOYSA-N.
| Molecular formula | C12H16BNO4S |
|---|---|
| Molecular weight | 281.14 g/mol |
| IUPAC name | [4-(1-methylsulfonyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]boronic acid |
| InChIKey | XUYQXOSHBCQDRS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CCN(CC2)S(=O)(=O)C)(O)O |
Computed by PubChem (NCBI)