CAS 2377587-38-5 is the registry number for 1,4-Dimethyl 2-[(tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]butanedioate, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.
Dimethyl 2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]butanedioate (CAS 2377587-38-5) is a chemical compound with the molecular formula C13H23BO6 and a molecular weight of 286.13 g/mol. IUPAC name: dimethyl 2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]butanedioate. InChIKey: FKOXOYYWJNKKMG-UHFFFAOYSA-N.
| Molecular formula | C13H23BO6 |
|---|---|
| Molecular weight | 286.13 g/mol |
| IUPAC name | dimethyl 2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]butanedioate |
| InChIKey | FKOXOYYWJNKKMG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC(CC(=O)OC)C(=O)OC |
Computed by PubChem (NCBI)