CAS 2377587-60-3 appears in our catalog under these names: 2-Piperidinone-4-boronic acid, pinacol ester, 98%, 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-2-one, 97%, 2-Piperidinone-4-boronic acid, pinacol ester. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 250mg, 5g, 10g, 50mg, 0,5g.
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-2-one (CAS 2377587-60-3) is a chemical compound with the molecular formula C11H20BNO3 and a molecular weight of 225.09 g/mol. IUPAC name: 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-2-one. InChIKey: WBSJJIXTNFHHGJ-UHFFFAOYSA-N.
| Molecular formula | C11H20BNO3 |
|---|---|
| Molecular weight | 225.09 g/mol |
| IUPAC name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidin-2-one |
| InChIKey | WBSJJIXTNFHHGJ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCNC(=O)C2 |
Computed by PubChem (NCBI)