CAS 2377603-56-8 is the registry number for (1S,4R)-Camphorsulfonate pyrrolidine-2-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
[(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;pyrrolidin-2-ylboronic acid (CAS 2377603-56-8) is a chemical compound with the molecular formula C14H26BNO6S and a molecular weight of 347.2 g/mol. IUPAC name: [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;pyrrolidin-2-ylboronic acid. InChIKey: SFBYRZFYJPZUGG-YZUKSGEXSA-N.
| Molecular formula | C14H26BNO6S |
|---|---|
| Molecular weight | 347.2 g/mol |
| IUPAC name | [(1S,4R)-7,7-dimethyl-2-oxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;pyrrolidin-2-ylboronic acid |
| InChIKey | SFBYRZFYJPZUGG-YZUKSGEXSA-N |
| SMILES | B(C1CCCN1)(O)O.CC1([C@@H]2CC[C@]1(C(=O)C2)CS(=O)(=O)O)C |
Computed by PubChem (NCBI)