CAS 2377605-75-7 is the registry number for 3-Chloropyridine-4-boronic acid hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
(3-chloro-4-pyridinyl)boronic acid;hydrochloride (CAS 2377605-75-7) is a chemical compound with the molecular formula C5H6BCl2NO2 and a molecular weight of 193.82 g/mol. IUPAC name: (3-chloro-4-pyridinyl)boronic acid;hydrochloride. InChIKey: CJMFGBTWYYWUSM-UHFFFAOYSA-N.
| Molecular formula | C5H6BCl2NO2 |
|---|---|
| Molecular weight | 193.82 g/mol |
| IUPAC name | (3-chloro-4-pyridinyl)boronic acid;hydrochloride |
| InChIKey | CJMFGBTWYYWUSM-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=NC=C1)Cl)(O)O.Cl |
Computed by PubChem (NCBI)