Products 2377605-75-7

CAS 2377605-75-7 is the registry number for 3-Chloropyridine-4-boronic acid hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

(3-chloro-4-pyridinyl)boronic acid;hydrochloride (CAS 2377605-75-7) is a chemical compound with the molecular formula C5H6BCl2NO2 and a molecular weight of 193.82 g/mol. IUPAC name: (3-chloro-4-pyridinyl)boronic acid;hydrochloride. InChIKey: CJMFGBTWYYWUSM-UHFFFAOYSA-N.

Identity
Molecular formulaC5H6BCl2NO2
Molecular weight193.82 g/mol
IUPAC name(3-chloro-4-pyridinyl)boronic acid;hydrochloride
InChIKeyCJMFGBTWYYWUSM-UHFFFAOYSA-N
SMILESB(C1=C(C=NC=C1)Cl)(O)O.Cl

Computed by PubChem (NCBI)