Products 2377605-81-5

CAS 2377605-81-5 is the registry number for 2-Chloro-5-(methoxycarbonyl)-3-nitrophenylboronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(2-chloro-5-methoxycarbonyl-3-nitrophenyl)boronic acid (CAS 2377605-81-5) is a chemical compound with the molecular formula C8H7BClNO6 and a molecular weight of 259.41 g/mol. IUPAC name: (2-chloro-5-methoxycarbonyl-3-nitrophenyl)boronic acid. InChIKey: NSBGPHGUTLDLOV-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7BClNO6
Molecular weight259.41 g/mol
IUPAC name(2-chloro-5-methoxycarbonyl-3-nitrophenyl)boronic acid
InChIKeyNSBGPHGUTLDLOV-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1Cl)[N+](=O)[O-])C(=O)OC)(O)O

Computed by PubChem (NCBI)