Products 2377605-84-8

CAS 2377605-84-8 is the registry number for 6-Isopropoxy-4-methylpyridine-3-boronic acid hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(4-methyl-6-propan-2-yloxy-3-pyridinyl)boronic acid;hydrochloride (CAS 2377605-84-8) is a chemical compound with the molecular formula C9H15BClNO3 and a molecular weight of 231.49 g/mol. IUPAC name: (4-methyl-6-propan-2-yloxy-3-pyridinyl)boronic acid;hydrochloride. InChIKey: SCJKGOZMRAHLSF-UHFFFAOYSA-N.

Identity
Molecular formulaC9H15BClNO3
Molecular weight231.49 g/mol
IUPAC name(4-methyl-6-propan-2-yloxy-3-pyridinyl)boronic acid;hydrochloride
InChIKeySCJKGOZMRAHLSF-UHFFFAOYSA-N
SMILESB(C1=CN=C(C=C1C)OC(C)C)(O)O.Cl

Computed by PubChem (NCBI)