CAS 2377605-84-8 is the registry number for 6-Isopropoxy-4-methylpyridine-3-boronic acid hydrochloride, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(4-methyl-6-propan-2-yloxy-3-pyridinyl)boronic acid;hydrochloride (CAS 2377605-84-8) is a chemical compound with the molecular formula C9H15BClNO3 and a molecular weight of 231.49 g/mol. IUPAC name: (4-methyl-6-propan-2-yloxy-3-pyridinyl)boronic acid;hydrochloride. InChIKey: SCJKGOZMRAHLSF-UHFFFAOYSA-N.
| Molecular formula | C9H15BClNO3 |
|---|---|
| Molecular weight | 231.49 g/mol |
| IUPAC name | (4-methyl-6-propan-2-yloxy-3-pyridinyl)boronic acid;hydrochloride |
| InChIKey | SCJKGOZMRAHLSF-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1C)OC(C)C)(O)O.Cl |
Computed by PubChem (NCBI)