CAS 2377605-86-0 appears in our catalog under these names: (4-{[2-(Trimethylsilyl)ethoxy]carbonyl}phenyl)boronic acid, 98%, (4-{(2-(Trimethylsilyl)ethoxy)carbonyl}phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 5g, 1g.
[4-(2-trimethylsilylethoxycarbonyl)phenyl]boronic acid (CAS 2377605-86-0) is a chemical compound with the molecular formula C12H19BO4Si and a molecular weight of 266.17 g/mol. IUPAC name: [4-(2-trimethylsilylethoxycarbonyl)phenyl]boronic acid. InChIKey: FIQFYQQEWOPKPO-UHFFFAOYSA-N.
| Molecular formula | C12H19BO4Si |
|---|---|
| Molecular weight | 266.17 g/mol |
| IUPAC name | [4-(2-trimethylsilylethoxycarbonyl)phenyl]boronic acid |
| InChIKey | FIQFYQQEWOPKPO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)OCC[Si](C)(C)C)(O)O |
Computed by PubChem (NCBI)