CAS 2377605-98-4 appears in our catalog under these names: 5-Nitro-2-(phenylselanyl)phenylboronic acid, 95%, (5-Nitro-2-(phenylselanyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
(5-nitro-2-phenylselanylphenyl)boronic acid (CAS 2377605-98-4) is a chemical compound with the molecular formula C12H10BNO4Se and a molecular weight of 322.00 g/mol. IUPAC name: (5-nitro-2-phenylselanylphenyl)boronic acid. InChIKey: NHXPBMXHHRFTSR-UHFFFAOYSA-N.
| Molecular formula | C12H10BNO4Se |
|---|---|
| Molecular weight | 322.00 g/mol |
| IUPAC name | (5-nitro-2-phenylselanylphenyl)boronic acid |
| InChIKey | NHXPBMXHHRFTSR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)[N+](=O)[O-])[Se]C2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)