CAS 2377606-40-9 appears in our catalog under these names: 4,6-Dibromo-2-fluoro-3-methoxyphenylboronic acid, 95%, (4,6-Dibromo-2-fluoro-3-methoxyphenyl)boronic acid, 98%, (4,6-Dibromo-2-fluoro-3-methoxyphenyl)boronic acid, ≥95%, ≥95%, 4,6-Dibromo-2-fluoro-3-methoxyphenylboronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(4,6-dibromo-2-fluoro-3-methoxyphenyl)boronic acid (CAS 2377606-40-9) is a chemical compound with the molecular formula C7H6BBr2FO3 and a molecular weight of 327.74 g/mol. IUPAC name: (4,6-dibromo-2-fluoro-3-methoxyphenyl)boronic acid. InChIKey: XMAPPCWXIAXOOR-UHFFFAOYSA-N.
| Molecular formula | C7H6BBr2FO3 |
|---|---|
| Molecular weight | 327.74 g/mol |
| IUPAC name | (4,6-dibromo-2-fluoro-3-methoxyphenyl)boronic acid |
| InChIKey | XMAPPCWXIAXOOR-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1Br)Br)OC)F)(O)O |
Computed by PubChem (NCBI)