CAS 2377606-44-3 appears in our catalog under these names: [2-(Benzyloxy)-5-chloro-6-methylpyridin-3-yl]boronic acid, 98%, (2-(Benzyloxy)-5-chloro-6-methylpyridin-3-yl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(5-chloro-6-methyl-2-phenylmethoxy-3-pyridinyl)boronic acid (CAS 2377606-44-3) is a chemical compound with the molecular formula C13H13BClNO3 and a molecular weight of 277.51 g/mol. IUPAC name: (5-chloro-6-methyl-2-phenylmethoxy-3-pyridinyl)boronic acid. InChIKey: JXZOTWYHSJVMQD-UHFFFAOYSA-N.
| Molecular formula | C13H13BClNO3 |
|---|---|
| Molecular weight | 277.51 g/mol |
| IUPAC name | (5-chloro-6-methyl-2-phenylmethoxy-3-pyridinyl)boronic acid |
| InChIKey | JXZOTWYHSJVMQD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1OCC2=CC=CC=C2)C)Cl)(O)O |
Computed by PubChem (NCBI)