CAS 2377606-56-7 is the registry number for 2-Bromo-6-fluoro-3-hydroxyphenylboronic acid pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-bromo-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol (CAS 2377606-56-7) is a chemical compound with the molecular formula C12H15BBrFO3 and a molecular weight of 316.96 g/mol. IUPAC name: 2-bromo-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol. InChIKey: SETHGHNSIQBWBM-UHFFFAOYSA-N.
| Molecular formula | C12H15BBrFO3 |
|---|---|
| Molecular weight | 316.96 g/mol |
| IUPAC name | 2-bromo-4-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol |
| InChIKey | SETHGHNSIQBWBM-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2Br)O)F |
Computed by PubChem (NCBI)