CAS 2377606-65-8 appears in our catalog under these names: N-(Ethanesulfonyl)piperidine-4-boronic acid pinacol ester, 98%, 1-(Ethylsulfonyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
1-ethylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine (CAS 2377606-65-8) is a chemical compound with the molecular formula C13H26BNO4S and a molecular weight of 303.2 g/mol. IUPAC name: 1-ethylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine. InChIKey: DUTYIPIWIRMLMD-UHFFFAOYSA-N.
| Molecular formula | C13H26BNO4S |
|---|---|
| Molecular weight | 303.2 g/mol |
| IUPAC name | 1-ethylsulfonyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)piperidine |
| InChIKey | DUTYIPIWIRMLMD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2CCN(CC2)S(=O)(=O)CC |
Computed by PubChem (NCBI)