CAS 2377606-74-9 is the registry number for 4-Bromo-2-fluoro-3-methoxy-6-nitrophenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4-bromo-2-fluoro-3-methoxy-6-nitrophenyl)boronic acid (CAS 2377606-74-9) is a chemical compound with the molecular formula C7H6BBrFNO5 and a molecular weight of 293.84 g/mol. IUPAC name: (4-bromo-2-fluoro-3-methoxy-6-nitrophenyl)boronic acid. InChIKey: LGRLVTRJWTYSFK-UHFFFAOYSA-N.
| Molecular formula | C7H6BBrFNO5 |
|---|---|
| Molecular weight | 293.84 g/mol |
| IUPAC name | (4-bromo-2-fluoro-3-methoxy-6-nitrophenyl)boronic acid |
| InChIKey | LGRLVTRJWTYSFK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1[N+](=O)[O-])Br)OC)F)(O)O |
Computed by PubChem (NCBI)