CAS 2377606-77-2 is the registry number for {5-[(2,2-Dimethylpropoxy)sulfonyl]pyridin-3-yl}boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[5-(2,2-dimethylpropoxysulfonyl)-3-pyridinyl]boronic acid (CAS 2377606-77-2) is a chemical compound with the molecular formula C10H16BNO5S and a molecular weight of 273.12 g/mol. IUPAC name: [5-(2,2-dimethylpropoxysulfonyl)-3-pyridinyl]boronic acid. InChIKey: PILYKMVMDZWTNH-UHFFFAOYSA-N.
| Molecular formula | C10H16BNO5S |
|---|---|
| Molecular weight | 273.12 g/mol |
| IUPAC name | [5-(2,2-dimethylpropoxysulfonyl)-3-pyridinyl]boronic acid |
| InChIKey | PILYKMVMDZWTNH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1)S(=O)(=O)OCC(C)(C)C)(O)O |
Computed by PubChem (NCBI)