CAS 2377606-79-4 appears in our catalog under these names: 2,3-Difluoro-4-methoxy-1,5-phenylenediboronic acid, 95%, (4,5-Difluoro-6-methoxy-1,3-phenylene)diboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
(5-borono-2,3-difluoro-4-methoxyphenyl)boronic acid (CAS 2377606-79-4) is a chemical compound with the molecular formula C7H8B2F2O5 and a molecular weight of 231.76 g/mol. IUPAC name: (5-borono-2,3-difluoro-4-methoxyphenyl)boronic acid. InChIKey: QNBRIPUELWMWKD-UHFFFAOYSA-N.
| Molecular formula | C7H8B2F2O5 |
|---|---|
| Molecular weight | 231.76 g/mol |
| IUPAC name | (5-borono-2,3-difluoro-4-methoxyphenyl)boronic acid |
| InChIKey | QNBRIPUELWMWKD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1OC)F)F)B(O)O)(O)O |
Computed by PubChem (NCBI)