CAS 2377607-13-9 is the registry number for 2-Ethoxy-5-fluoro-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-ethoxy-5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (CAS 2377607-13-9) is a chemical compound with the molecular formula C15H19BFNO3 and a molecular weight of 291.13 g/mol. IUPAC name: 2-ethoxy-5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile. InChIKey: LPQVEMXQUBGGHK-UHFFFAOYSA-N.
| Molecular formula | C15H19BFNO3 |
|---|---|
| Molecular weight | 291.13 g/mol |
| IUPAC name | 2-ethoxy-5-fluoro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| InChIKey | LPQVEMXQUBGGHK-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2F)C#N)OCC |
Computed by PubChem (NCBI)