CAS 2377607-38-8 is the registry number for 3-Fluoro-4-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
3-fluoro-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]aniline (CAS 2377607-38-8) is a chemical compound with the molecular formula C18H21BFNO3 and a molecular weight of 329.2 g/mol. IUPAC name: 3-fluoro-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]aniline. InChIKey: WYSIPRIXJXXQLO-UHFFFAOYSA-N.
| Molecular formula | C18H21BFNO3 |
|---|---|
| Molecular weight | 329.2 g/mol |
| IUPAC name | 3-fluoro-4-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]aniline |
| InChIKey | WYSIPRIXJXXQLO-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)OC3=C(C=C(C=C3)N)F |
Computed by PubChem (NCBI)