CAS 2377607-78-6 is the registry number for 2-Chloro-6-fluoropyridine-3,5-diboronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
2-chloro-6-fluoro-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 2377607-78-6) is a chemical compound with the molecular formula C17H25B2ClFNO4 and a molecular weight of 383.5 g/mol. IUPAC name: 2-chloro-6-fluoro-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: UWSVQIUTFHCODD-UHFFFAOYSA-N.
| Molecular formula | C17H25B2ClFNO4 |
|---|---|
| Molecular weight | 383.5 g/mol |
| IUPAC name | 2-chloro-6-fluoro-3,5-bis(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine |
| InChIKey | UWSVQIUTFHCODD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(N=C2F)Cl)B3OC(C(O3)(C)C)(C)C |
Computed by PubChem (NCBI)