CAS 2377607-79-7 is the registry number for 2-(Dimethylsulfamoyl)pyrazole-3-boronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
[2-(dimethylsulfamoyl)pyrazol-3-yl]boronic acid (CAS 2377607-79-7) is a chemical compound with the molecular formula C5H10BN3O4S and a molecular weight of 219.03 g/mol. IUPAC name: [2-(dimethylsulfamoyl)pyrazol-3-yl]boronic acid. InChIKey: VUCGKMPCSGUOBC-UHFFFAOYSA-N.
| Molecular formula | C5H10BN3O4S |
|---|---|
| Molecular weight | 219.03 g/mol |
| IUPAC name | [2-(dimethylsulfamoyl)pyrazol-3-yl]boronic acid |
| InChIKey | VUCGKMPCSGUOBC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=NN1S(=O)(=O)N(C)C)(O)O |
Computed by PubChem (NCBI)