Products 2377607-89-9

CAS 2377607-89-9 is the registry number for 4-Methoxy-2-(methylthio)pyrimidin-5-ylboronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

(4-methoxy-2-methylsulfanylpyrimidin-5-yl)boronic acid (CAS 2377607-89-9) is a chemical compound with the molecular formula C6H9BN2O3S and a molecular weight of 200.03 g/mol. IUPAC name: (4-methoxy-2-methylsulfanylpyrimidin-5-yl)boronic acid. InChIKey: CNITUHWYVVJCSE-UHFFFAOYSA-N.

Identity
Molecular formulaC6H9BN2O3S
Molecular weight200.03 g/mol
IUPAC name(4-methoxy-2-methylsulfanylpyrimidin-5-yl)boronic acid
InChIKeyCNITUHWYVVJCSE-UHFFFAOYSA-N
SMILESB(C1=CN=C(N=C1OC)SC)(O)O

Computed by PubChem (NCBI)