CAS 2377608-11-0 appears in our catalog under these names: 4-Chlorothieno[2,3-d]pyrimidine-6-boronic acid, 95%, 4-CHlorothieno(2,3-d)pyrimidine-6-boronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 1g, 250mg.
(4-chlorothieno[2,3-d]pyrimidin-6-yl)boronic acid (CAS 2377608-11-0) is a chemical compound with the molecular formula C6H4BClN2O2S and a molecular weight of 214.44 g/mol. IUPAC name: (4-chlorothieno[2,3-d]pyrimidin-6-yl)boronic acid. InChIKey: LJLBJJXFTWQPLG-UHFFFAOYSA-N.
| Molecular formula | C6H4BClN2O2S |
|---|---|
| Molecular weight | 214.44 g/mol |
| IUPAC name | (4-chlorothieno[2,3-d]pyrimidin-6-yl)boronic acid |
| InChIKey | LJLBJJXFTWQPLG-UHFFFAOYSA-N |
| SMILES | B(C1=CC2=C(S1)N=CN=C2Cl)(O)O |
Computed by PubChem (NCBI)