CAS 2377608-18-7 is the registry number for 2-Fluoro-5-(1-(methoxycarbonyl)cyclopropyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[2-fluoro-5-(1-methoxycarbonylcyclopropyl)phenyl]boronic acid (CAS 2377608-18-7) is a chemical compound with the molecular formula C11H12BFO4 and a molecular weight of 238.02 g/mol. IUPAC name: [2-fluoro-5-(1-methoxycarbonylcyclopropyl)phenyl]boronic acid. InChIKey: ALKIONORIVSKPI-UHFFFAOYSA-N.
| Molecular formula | C11H12BFO4 |
|---|---|
| Molecular weight | 238.02 g/mol |
| IUPAC name | [2-fluoro-5-(1-methoxycarbonylcyclopropyl)phenyl]boronic acid |
| InChIKey | ALKIONORIVSKPI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C2(CC2)C(=O)OC)F)(O)O |
Computed by PubChem (NCBI)