CAS 2377608-20-1 appears in our catalog under these names: 3-Borono-6-bromo-2-fluorophenylboronic acid pinacol ester, 96%, (4-Bromo-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 100mg, 250mg.
[4-bromo-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]boronic acid (CAS 2377608-20-1) is a chemical compound with the molecular formula C12H16B2BrFO4 and a molecular weight of 344.8 g/mol. IUPAC name: [4-bromo-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]boronic acid. InChIKey: QELXWNDMLJVYFB-UHFFFAOYSA-N.
| Molecular formula | C12H16B2BrFO4 |
|---|---|
| Molecular weight | 344.8 g/mol |
| IUPAC name | [4-bromo-2-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]boronic acid |
| InChIKey | QELXWNDMLJVYFB-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=CC(=C2F)B(O)O)Br |
Computed by PubChem (NCBI)