CAS 2377608-24-5 is the registry number for [5-Amino-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
[5-amino-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid (CAS 2377608-24-5) is a chemical compound with the molecular formula C7H6BF4NO2 and a molecular weight of 222.93 g/mol. IUPAC name: [5-amino-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid. InChIKey: DQEYZNDYUUWUNB-UHFFFAOYSA-N.
| Molecular formula | C7H6BF4NO2 |
|---|---|
| Molecular weight | 222.93 g/mol |
| IUPAC name | [5-amino-2-fluoro-3-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | DQEYZNDYUUWUNB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)C(F)(F)F)N)(O)O |
Computed by PubChem (NCBI)