CAS 2377608-32-5 appears in our catalog under these names: (3-BOC-Amino)-2-methoxyphenylboronic acid, 96%, (3-((tert-Butoxycarbonyl)amino)-2-methoxyphenyl)boronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
[2-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid (CAS 2377608-32-5) is a chemical compound with the molecular formula C12H18BNO5 and a molecular weight of 267.09 g/mol. IUPAC name: [2-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid. InChIKey: XVAVIHWWFSSREL-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO5 |
|---|---|
| Molecular weight | 267.09 g/mol |
| IUPAC name | [2-methoxy-3-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]boronic acid |
| InChIKey | XVAVIHWWFSSREL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)NC(=O)OC(C)(C)C)OC)(O)O |
Computed by PubChem (NCBI)