Products 2377608-41-6

CAS 2377608-41-6 is the registry number for 5-Fluoro-2-nitro-4-(trifluoromethyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.

Structural formula: {0} (CAS {1})

[5-fluoro-2-nitro-4-(trifluoromethyl)phenyl]boronic acid (CAS 2377608-41-6) is a chemical compound with the molecular formula C7H4BF4NO4 and a molecular weight of 252.92 g/mol. IUPAC name: [5-fluoro-2-nitro-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: WGIQLIQTHKOGAP-UHFFFAOYSA-N.

Identity
Molecular formulaC7H4BF4NO4
Molecular weight252.92 g/mol
IUPAC name[5-fluoro-2-nitro-4-(trifluoromethyl)phenyl]boronic acid
InChIKeyWGIQLIQTHKOGAP-UHFFFAOYSA-N
SMILESB(C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)F)(O)O

Computed by PubChem (NCBI)