CAS 2377608-41-6 is the registry number for 5-Fluoro-2-nitro-4-(trifluoromethyl)phenylboronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g.
[5-fluoro-2-nitro-4-(trifluoromethyl)phenyl]boronic acid (CAS 2377608-41-6) is a chemical compound with the molecular formula C7H4BF4NO4 and a molecular weight of 252.92 g/mol. IUPAC name: [5-fluoro-2-nitro-4-(trifluoromethyl)phenyl]boronic acid. InChIKey: WGIQLIQTHKOGAP-UHFFFAOYSA-N.
| Molecular formula | C7H4BF4NO4 |
|---|---|
| Molecular weight | 252.92 g/mol |
| IUPAC name | [5-fluoro-2-nitro-4-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | WGIQLIQTHKOGAP-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1[N+](=O)[O-])C(F)(F)F)F)(O)O |
Computed by PubChem (NCBI)