Products 2377608-44-9

CAS 2377608-44-9 is the registry number for 3-(Benzyloxy)-5-(methoxycarbonyl)phenylboronic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

(3-methoxycarbonyl-5-phenylmethoxyphenyl)boronic acid (CAS 2377608-44-9) is a chemical compound with the molecular formula C15H15BO5 and a molecular weight of 286.09 g/mol. IUPAC name: (3-methoxycarbonyl-5-phenylmethoxyphenyl)boronic acid. InChIKey: KTUCVFRAZQCPNK-UHFFFAOYSA-N.

Identity
Molecular formulaC15H15BO5
Molecular weight286.09 g/mol
IUPAC name(3-methoxycarbonyl-5-phenylmethoxyphenyl)boronic acid
InChIKeyKTUCVFRAZQCPNK-UHFFFAOYSA-N
SMILESB(C1=CC(=CC(=C1)OCC2=CC=CC=C2)C(=O)OC)(O)O

Computed by PubChem (NCBI)