CAS 2377608-57-4 is the registry number for 2,5-Dinitrothiophene-3-boronic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(2,5-dinitrothiophen-3-yl)boronic acid (CAS 2377608-57-4) is a chemical compound with the molecular formula C4H3BN2O6S and a molecular weight of 217.96 g/mol. IUPAC name: (2,5-dinitrothiophen-3-yl)boronic acid. InChIKey: PWEOLFDEXPOHGM-UHFFFAOYSA-N.
| Molecular formula | C4H3BN2O6S |
|---|---|
| Molecular weight | 217.96 g/mol |
| IUPAC name | (2,5-dinitrothiophen-3-yl)boronic acid |
| InChIKey | PWEOLFDEXPOHGM-UHFFFAOYSA-N |
| SMILES | B(C1=C(SC(=C1)[N+](=O)[O-])[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)