CAS 2377608-64-3 is the registry number for (2,3-Difluoro-6-methoxy-5-nitrophenyl)boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2,3-difluoro-6-methoxy-5-nitrophenyl)boronic acid (CAS 2377608-64-3) is a chemical compound with the molecular formula C7H6BF2NO5 and a molecular weight of 232.94 g/mol. IUPAC name: (2,3-difluoro-6-methoxy-5-nitrophenyl)boronic acid. InChIKey: DJZNHLQUELCRIO-UHFFFAOYSA-N.
| Molecular formula | C7H6BF2NO5 |
|---|---|
| Molecular weight | 232.94 g/mol |
| IUPAC name | (2,3-difluoro-6-methoxy-5-nitrophenyl)boronic acid |
| InChIKey | DJZNHLQUELCRIO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC(=C1F)F)[N+](=O)[O-])OC)(O)O |
Computed by PubChem (NCBI)