CAS 2377608-71-2 appears in our catalog under these names: {4-[(2,2-dimethylpropoxy)sulfonyl]-3-methylphenyl}boronic acid, 98%, {4-((2,2-dimethylpropoxy)sulfonyl)-3-methylphenyl}boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 10g.
[4-(2,2-dimethylpropoxysulfonyl)-3-methylphenyl]boronic acid (CAS 2377608-71-2) is a chemical compound with the molecular formula C12H19BO5S and a molecular weight of 286.16 g/mol. IUPAC name: [4-(2,2-dimethylpropoxysulfonyl)-3-methylphenyl]boronic acid. InChIKey: SWADKSRKJNPZBK-UHFFFAOYSA-N.
| Molecular formula | C12H19BO5S |
|---|---|
| Molecular weight | 286.16 g/mol |
| IUPAC name | [4-(2,2-dimethylpropoxysulfonyl)-3-methylphenyl]boronic acid |
| InChIKey | SWADKSRKJNPZBK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)S(=O)(=O)OCC(C)(C)C)C)(O)O |
Computed by PubChem (NCBI)