CAS 2377608-85-8 is the registry number for 1-Benzyl-4-bromopyrazole-5-boronic acid, pinacol ester, 98%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
1-benzyl-4-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (CAS 2377608-85-8) is a chemical compound with the molecular formula C16H20BBrN2O2 and a molecular weight of 363.1 g/mol. IUPAC name: 1-benzyl-4-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole. InChIKey: QKWRTLHBAJSWHY-UHFFFAOYSA-N.
| Molecular formula | C16H20BBrN2O2 |
|---|---|
| Molecular weight | 363.1 g/mol |
| IUPAC name | 1-benzyl-4-bromo-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| InChIKey | QKWRTLHBAJSWHY-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C=NN2CC3=CC=CC=C3)Br |
Computed by PubChem (NCBI)