CAS 2377608-96-1 is the registry number for 4-Fluoro-3-(N-BOC-N-methylamino)phenylboronic acid pinacol ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
Tert-butyl N-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methylcarbamate (CAS 2377608-96-1) is a chemical compound with the molecular formula C18H27BFNO4 and a molecular weight of 351.2 g/mol. IUPAC name: tert-butyl N-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methylcarbamate. InChIKey: DZZBZFADICZHFV-UHFFFAOYSA-N.
| Molecular formula | C18H27BFNO4 |
|---|---|
| Molecular weight | 351.2 g/mol |
| IUPAC name | tert-butyl N-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-N-methylcarbamate |
| InChIKey | DZZBZFADICZHFV-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)F)N(C)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)