CAS 2377608-99-4 appears in our catalog under these names: 6-Bromo-8-fluoroquinoline-3-boronic acid pinacol ester, 96%, 6-Bromo-8-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
6-bromo-8-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline (CAS 2377608-99-4) is a chemical compound with the molecular formula C15H16BBrFNO2 and a molecular weight of 352.01 g/mol. IUPAC name: 6-bromo-8-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline. InChIKey: IDIOVYKZPQKGSQ-UHFFFAOYSA-N.
| Molecular formula | C15H16BBrFNO2 |
|---|---|
| Molecular weight | 352.01 g/mol |
| IUPAC name | 6-bromo-8-fluoro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinoline |
| InChIKey | IDIOVYKZPQKGSQ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC3=CC(=CC(=C3N=C2)F)Br |
Computed by PubChem (NCBI)