CAS 2377609-05-5 is the registry number for 4,7-Dibromo-3-methoxynaphthalene-1-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(4,7-dibromo-3-methoxynaphthalen-1-yl)boronic acid (CAS 2377609-05-5) is a chemical compound with the molecular formula C11H9BBr2O3 and a molecular weight of 359.81 g/mol. IUPAC name: (4,7-dibromo-3-methoxynaphthalen-1-yl)boronic acid. InChIKey: BJALALLCOHYLTI-UHFFFAOYSA-N.
| Molecular formula | C11H9BBr2O3 |
|---|---|
| Molecular weight | 359.81 g/mol |
| IUPAC name | (4,7-dibromo-3-methoxynaphthalen-1-yl)boronic acid |
| InChIKey | BJALALLCOHYLTI-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C2=C1C=C(C=C2)Br)Br)OC)(O)O |
Computed by PubChem (NCBI)