CAS 2377609-08-8 is the registry number for 6-Chloro-4-fluoro-3-methoxy-2-nitrophenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(6-chloro-4-fluoro-3-methoxy-2-nitrophenyl)boronic acid (CAS 2377609-08-8) is a chemical compound with the molecular formula C7H6BClFNO5 and a molecular weight of 249.39 g/mol. IUPAC name: (6-chloro-4-fluoro-3-methoxy-2-nitrophenyl)boronic acid. InChIKey: VCKFMVDKRUUTOQ-UHFFFAOYSA-N.
| Molecular formula | C7H6BClFNO5 |
|---|---|
| Molecular weight | 249.39 g/mol |
| IUPAC name | (6-chloro-4-fluoro-3-methoxy-2-nitrophenyl)boronic acid |
| InChIKey | VCKFMVDKRUUTOQ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C(=C1[N+](=O)[O-])OC)F)Cl)(O)O |
Computed by PubChem (NCBI)