CAS 2377609-27-1 is the registry number for 2-Hydroxy-5-(trifluoromethylthio)phenylboronic acid, 96%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
[2-hydroxy-5-(trifluoromethylsulfanyl)phenyl]boronic acid (CAS 2377609-27-1) is a chemical compound with the molecular formula C7H6BF3O3S and a molecular weight of 238.00 g/mol. IUPAC name: [2-hydroxy-5-(trifluoromethylsulfanyl)phenyl]boronic acid. InChIKey: WQIVBVNQEZZDKK-UHFFFAOYSA-N.
| Molecular formula | C7H6BF3O3S |
|---|---|
| Molecular weight | 238.00 g/mol |
| IUPAC name | [2-hydroxy-5-(trifluoromethylsulfanyl)phenyl]boronic acid |
| InChIKey | WQIVBVNQEZZDKK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)SC(F)(F)F)O)(O)O |
Computed by PubChem (NCBI)