CAS 2377609-60-2 appears in our catalog under these names: 4-(Cbz-Amino)naphthalene-1-boronic acid pinacol ester, 98%, Benzyl (4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl)carbamate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 1g.
Benzyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]carbamate (CAS 2377609-60-2) is a chemical compound with the molecular formula C24H26BNO4 and a molecular weight of 403.3 g/mol. IUPAC name: benzyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]carbamate. InChIKey: VSWVMONVJYCRRF-UHFFFAOYSA-N.
| Molecular formula | C24H26BNO4 |
|---|---|
| Molecular weight | 403.3 g/mol |
| IUPAC name | benzyl N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-1-yl]carbamate |
| InChIKey | VSWVMONVJYCRRF-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C3=CC=CC=C23)NC(=O)OCC4=CC=CC=C4 |
Computed by PubChem (NCBI)